C32H27ClN2O3 — CID 126000599
(E)-N-(3-chloro-2-methylphenyl)-2-cyano-3-[3-methoxy-4-(naphthalen-2-ylmethoxy)-5-prop-2-enylphenyl]prop-2-enamide (PubChem CID 126000599) has the molecular formula C32H27ClN2O3 and a molecular weight of 523.03 g/mol. Its IUPAC name is (E)-N-(3-chloro-2-methylphenyl)-2-cyano-3-[3-methoxy-4-(naphthalen-2-ylmethoxy)-5-prop-2-enylphenyl]prop-2-enamide.
| Compound Name | (E)-N-(3-chloro-2-methylphenyl)-2-cyano-3-[3-methoxy-4-(naphthalen-2-ylmethoxy)-5-prop-2-enylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126000599 |
| Molecular Formula | C32H27ClN2O3 |
| Molecular Weight | 523.03 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | (E)-N-(3-chloro-2-methylphenyl)-2-cyano-3-[3-methoxy-4-(naphthalen-2-ylmethoxy)-5-prop-2-enylphenyl]prop-2-enamide |
| SMILES | C=CCc1cc(/C=C(\C#N)C(=O)Nc2cccc(Cl)c2C)cc(OC)c1OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C32H27ClN2O3/c1-4-8-26-16-23(17-27(19-34)32(36)35-29-12-7-11-28(33)21(29)2)18-30(37-3)31(26)38-20-22-13-14-24-9-5-6-10-25(24)15-22/h4-7,9-18H,1,8,20H2,2-3H3,(H,35,36)/b27-17+ |
| InChIKey | XTACYOXITJWYDC-WPWMEQJKSA-N |
| XLogP | 7.66 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.03 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|