C29H27FN2O3 — CID 126080922
(E)-2-cyano-N-(2,4-dimethylphenyl)-3-[4-[(2-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]prop-2-enamide (PubChem CID 126080922) has the molecular formula C29H27FN2O3 and a molecular weight of 470.54 g/mol. Its IUPAC name is (E)-2-cyano-N-(2,4-dimethylphenyl)-3-[4-[(2-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2,4-dimethylphenyl)-3-[4-[(2-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126080922 |
| Molecular Formula | C29H27FN2O3 |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | (E)-2-cyano-N-(2,4-dimethylphenyl)-3-[4-[(2-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]prop-2-enamide |
| SMILES | C=CCc1cc(/C=C(\C#N)C(=O)Nc2ccc(C)cc2C)cc(OC)c1OCc1ccccc1F |
| InChI | InChI=1S/C29H27FN2O3/c1-5-8-22-14-21(15-24(17-31)29(33)32-26-12-11-19(2)13-20(26)3)16-27(34-4)28(22)35-18-23-9-6-7-10-25(23)30/h5-7,9-16H,1,8,18H2,2-4H3,(H,32,33)/b24-15+ |
| InChIKey | MVTUBIGUYKQXRE-BUVRLJJBSA-N |
| XLogP | 6.30 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|