C30H29FN2O3 — CID 126074936
(E)-2-cyano-N-(2,4-dimethylphenyl)-3-[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-prop-2-enylphenyl]prop-2-enamide (PubChem CID 126074936) has the molecular formula C30H29FN2O3 and a molecular weight of 484.57 g/mol. Its IUPAC name is (E)-2-cyano-N-(2,4-dimethylphenyl)-3-[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-prop-2-enylphenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2,4-dimethylphenyl)-3-[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-prop-2-enylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126074936 |
| Molecular Formula | C30H29FN2O3 |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | (E)-2-cyano-N-(2,4-dimethylphenyl)-3-[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-prop-2-enylphenyl]prop-2-enamide |
| SMILES | C=CCc1cc(/C=C(\C#N)C(=O)Nc2ccc(C)cc2C)cc(OCC)c1OCc1ccccc1F |
| InChI | InChI=1S/C30H29FN2O3/c1-5-9-23-15-22(16-25(18-32)30(34)33-27-13-12-20(3)14-21(27)4)17-28(35-6-2)29(23)36-19-24-10-7-8-11-26(24)31/h5,7-8,10-17H,1,6,9,19H2,2-4H3,(H,33,34)/b25-16+ |
| InChIKey | RXKHPLCSTRSSMZ-PCLIKHOPSA-N |
| XLogP | 6.69 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|