C24H25ClN2O3 — CID 7333347
(Z)-N-(5-chloro-2-methylphenyl)-2-cyano-3-(3,4-diethoxy-5-prop-2-enylphenyl)prop-2-enamide (PubChem CID 7333347) has the molecular formula C24H25ClN2O3 and a molecular weight of 424.93 g/mol. Its IUPAC name is (Z)-N-(5-chloro-2-methylphenyl)-2-cyano-3-(3,4-diethoxy-5-prop-2-enylphenyl)prop-2-enamide.
| Compound Name | (Z)-N-(5-chloro-2-methylphenyl)-2-cyano-3-(3,4-diethoxy-5-prop-2-enylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 7333347 |
| Molecular Formula | C24H25ClN2O3 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | (Z)-N-(5-chloro-2-methylphenyl)-2-cyano-3-(3,4-diethoxy-5-prop-2-enylphenyl)prop-2-enamide |
| SMILES | C=CCc1cc(/C=C(/C#N)C(=O)Nc2cc(Cl)ccc2C)cc(OCC)c1OCC |
| InChI | InChI=1S/C24H25ClN2O3/c1-5-8-18-11-17(13-22(29-6-2)23(18)30-7-3)12-19(15-26)24(28)27-21-14-20(25)10-9-16(21)4/h5,9-14H,1,6-8H2,2-4H3,(H,27,28)/b19-12- |
| InChIKey | KZVPTCUAVATZNQ-UNOMPAQXSA-N |
| XLogP | 5.72 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|