C25H26N2O5 — CID 126082452
2-[4-[(E)-2-cyano-3-(2,3-dimethylanilino)-3-oxoprop-1-enyl]-2-ethoxy-6-prop-2-enylphenoxy]acetic acid (PubChem CID 126082452) has the molecular formula C25H26N2O5 and a molecular weight of 434.49 g/mol. Its IUPAC name is 2-[4-[(E)-2-cyano-3-(2,3-dimethylanilino)-3-oxoprop-1-enyl]-2-ethoxy-6-prop-2-enylphenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-2-cyano-3-(2,3-dimethylanilino)-3-oxoprop-1-enyl]-2-ethoxy-6-prop-2-enylphenoxy]acetic acid |
|---|---|
| PubChem CID | 126082452 |
| Molecular Formula | C25H26N2O5 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 2-[4-[(E)-2-cyano-3-(2,3-dimethylanilino)-3-oxoprop-1-enyl]-2-ethoxy-6-prop-2-enylphenoxy]acetic acid |
| SMILES | C=CCc1cc(/C=C(\C#N)C(=O)Nc2cccc(C)c2C)cc(OCC)c1OCC(=O)O |
| InChI | InChI=1S/C25H26N2O5/c1-5-8-19-11-18(13-22(31-6-2)24(19)32-15-23(28)29)12-20(14-26)25(30)27-21-10-7-9-16(3)17(21)4/h5,7,9-13H,1,6,8,15H2,2-4H3,(H,27,30)(H,28,29)/b20-12+ |
| InChIKey | XPZOIWZNMOCDBH-UDWIEESQSA-N |
| XLogP | 4.44 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|