C22H23N3O4 — CID 126221753
(Z)-3-[4-(2-amino-2-oxoethoxy)-3-ethoxyphenyl]-2-cyano-N-(2,3-dimethylphenyl)prop-2-enamide (PubChem CID 126221753) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is (Z)-3-[4-(2-amino-2-oxoethoxy)-3-ethoxyphenyl]-2-cyano-N-(2,3-dimethylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-[4-(2-amino-2-oxoethoxy)-3-ethoxyphenyl]-2-cyano-N-(2,3-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126221753 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (Z)-3-[4-(2-amino-2-oxoethoxy)-3-ethoxyphenyl]-2-cyano-N-(2,3-dimethylphenyl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nc2cccc(C)c2C)ccc1OCC(N)=O |
| InChI | InChI=1S/C22H23N3O4/c1-4-28-20-11-16(8-9-19(20)29-13-21(24)26)10-17(12-23)22(27)25-18-7-5-6-14(2)15(18)3/h5-11H,4,13H2,1-3H3,(H2,24,26)(H,25,27)/b17-10- |
| InChIKey | BARAJEHEATUZBS-YVLHZVERSA-N |
| XLogP | 3.11 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|