C24H25FO6 — CID 126071148
dimethyl 2-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]propanedioate (PubChem CID 126071148) has the molecular formula C24H25FO6 and a molecular weight of 428.46 g/mol. Its IUPAC name is dimethyl 2-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]propanedioate.
| Compound Name | dimethyl 2-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]propanedioate |
|---|---|
| PubChem CID | 126071148 |
| Molecular Formula | C24H25FO6 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | dimethyl 2-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]propanedioate |
| SMILES | C=CCc1cc(C=C(C(=O)OC)C(=O)OC)cc(OCC)c1OCc1ccccc1F |
| InChI | InChI=1S/C24H25FO6/c1-5-9-17-12-16(13-19(23(26)28-3)24(27)29-4)14-21(30-6-2)22(17)31-15-18-10-7-8-11-20(18)25/h5,7-8,10-14H,1,6,9,15H2,2-4H3 |
| InChIKey | FZQCLFOWPDXTDD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|