C31H25BrN2O2 — CID 124534484
(Z)-3-[3-bromo-4-(naphthalen-2-ylmethoxy)-5-prop-2-enylphenyl]-2-cyano-N-(4-methylphenyl)prop-2-enamide (PubChem CID 124534484) has the molecular formula C31H25BrN2O2 and a molecular weight of 537.46 g/mol. Its IUPAC name is (Z)-3-[3-bromo-4-(naphthalen-2-ylmethoxy)-5-prop-2-enylphenyl]-2-cyano-N-(4-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-[3-bromo-4-(naphthalen-2-ylmethoxy)-5-prop-2-enylphenyl]-2-cyano-N-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 124534484 |
| Molecular Formula | C31H25BrN2O2 |
| Molecular Weight | 537.46 g/mol |
| Exact Mass | 536.11 |
| IUPAC Name | (Z)-3-[3-bromo-4-(naphthalen-2-ylmethoxy)-5-prop-2-enylphenyl]-2-cyano-N-(4-methylphenyl)prop-2-enamide |
| SMILES | C=CCc1cc(/C=C(/C#N)C(=O)Nc2ccc(C)cc2)cc(Br)c1OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C31H25BrN2O2/c1-3-6-26-16-23(17-27(19-33)31(35)34-28-13-9-21(2)10-14-28)18-29(32)30(26)36-20-22-11-12-24-7-4-5-8-25(24)15-22/h3-5,7-18H,1,6,20H2,2H3,(H,34,35)/b27-17- |
| InChIKey | VDTHCXALYWTEMS-PKAZHMFMSA-N |
| XLogP | 7.76 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.46 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|