C27H23IN2O2 — CID 124534474
(Z)-2-cyano-3-[4-[(4-iodophenyl)methoxy]-3-prop-2-enylphenyl]-N-(4-methylphenyl)prop-2-enamide (PubChem CID 124534474) has the molecular formula C27H23IN2O2 and a molecular weight of 534.40 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-[(4-iodophenyl)methoxy]-3-prop-2-enylphenyl]-N-(4-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[4-[(4-iodophenyl)methoxy]-3-prop-2-enylphenyl]-N-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 124534474 |
| Molecular Formula | C27H23IN2O2 |
| Molecular Weight | 534.40 g/mol |
| Exact Mass | 534.08 |
| IUPAC Name | (Z)-2-cyano-3-[4-[(4-iodophenyl)methoxy]-3-prop-2-enylphenyl]-N-(4-methylphenyl)prop-2-enamide |
| SMILES | C=CCc1cc(/C=C(/C#N)C(=O)Nc2ccc(C)cc2)ccc1OCc1ccc(I)cc1 |
| InChI | InChI=1S/C27H23IN2O2/c1-3-4-22-15-21(9-14-26(22)32-18-20-7-10-24(28)11-8-20)16-23(17-29)27(31)30-25-12-5-19(2)6-13-25/h3,5-16H,1,4,18H2,2H3,(H,30,31)/b23-16- |
| InChIKey | PMXYCYRWGNDYTP-KQWNVCNZSA-N |
| XLogP | 6.45 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.40 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|