C30H34N4O3 — CID 1132228
1-[(E)-3-[1-[2-(4-tert-butylphenoxy)ethyl]indol-3-yl]-2-cyanoprop-2-enoyl]piperidine-4-carboxamide (PubChem CID 1132228) has the molecular formula C30H34N4O3 and a molecular weight of 498.63 g/mol. Its IUPAC name is 1-[(E)-3-[1-[2-(4-tert-butylphenoxy)ethyl]indol-3-yl]-2-cyanoprop-2-enoyl]piperidine-4-carboxamide.
| Compound Name | 1-[(E)-3-[1-[2-(4-tert-butylphenoxy)ethyl]indol-3-yl]-2-cyanoprop-2-enoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 1132228 |
| Molecular Formula | C30H34N4O3 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 1-[(E)-3-[1-[2-(4-tert-butylphenoxy)ethyl]indol-3-yl]-2-cyanoprop-2-enoyl]piperidine-4-carboxamide |
| SMILES | CC(C)(C)c1ccc(OCCn2cc(/C=C(\C#N)C(=O)N3CCC(C(N)=O)CC3)c3ccccc32)cc1 |
| InChI | InChI=1S/C30H34N4O3/c1-30(2,3)24-8-10-25(11-9-24)37-17-16-34-20-23(26-6-4-5-7-27(26)34)18-22(19-31)29(36)33-14-12-21(13-15-33)28(32)35/h4-11,18,20-21H,12-17H2,1-3H3,(H2,32,35)/b22-18+ |
| InChIKey | CWVPOMAAHCOHQT-RELWKKBWSA-N |
| XLogP | 4.65 |
| TPSA | 101.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|