C21H16N2O — CID 6296082
(E)-2-benzoyl-3-(1-prop-2-enylindol-3-yl)prop-2-enenitrile (PubChem CID 6296082) has the molecular formula C21H16N2O and a molecular weight of 312.37 g/mol. Its IUPAC name is (E)-2-benzoyl-3-(1-prop-2-enylindol-3-yl)prop-2-enenitrile.
| Compound Name | (E)-2-benzoyl-3-(1-prop-2-enylindol-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6296082 |
| Molecular Formula | C21H16N2O |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | (E)-2-benzoyl-3-(1-prop-2-enylindol-3-yl)prop-2-enenitrile |
| SMILES | C=CCn1cc(/C=C(\C#N)C(=O)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C21H16N2O/c1-2-12-23-15-18(19-10-6-7-11-20(19)23)13-17(14-22)21(24)16-8-4-3-5-9-16/h2-11,13,15H,1,12H2/b17-13+ |
| InChIKey | WQGJIZABGWRGON-GHRIWEEISA-N |
| XLogP | 4.62 |
| TPSA | 45.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|