C16H12BrIN2OS — CID 135501455
2-[(E)-(5-bromo-2-hydroxy-3-iodophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 135501455) has the molecular formula C16H12BrIN2OS and a molecular weight of 487.16 g/mol. Its IUPAC name is 2-[(E)-(5-bromo-2-hydroxy-3-iodophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | 2-[(E)-(5-bromo-2-hydroxy-3-iodophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 135501455 |
| Molecular Formula | C16H12BrIN2OS |
| Molecular Weight | 487.16 g/mol |
| Exact Mass | 485.89 |
| IUPAC Name | 2-[(E)-(5-bromo-2-hydroxy-3-iodophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | N#Cc1c(/N=C/c2cc(Br)cc(I)c2O)sc2c1CCCC2 |
| InChI | InChI=1S/C16H12BrIN2OS/c17-10-5-9(15(21)13(18)6-10)8-20-16-12(7-19)11-3-1-2-4-14(11)22-16/h5-6,8,21H,1-4H2/b20-8+ |
| InChIKey | BQAWLCDLZIABRF-DNTJNYDQSA-N |
| XLogP | 5.32 |
| TPSA | 56.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.16 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|