C42H38ClN3OS — CID 126084149
(6S)-6-tert-butyl-N-(4-chlorophenyl)-2-[(1,2,5-triphenylpyrrol-3-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126084149) has the molecular formula C42H38ClN3OS and a molecular weight of 668.31 g/mol. Its IUPAC name is (6S)-6-tert-butyl-N-(4-chlorophenyl)-2-[(1,2,5-triphenylpyrrol-3-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6S)-6-tert-butyl-N-(4-chlorophenyl)-2-[(1,2,5-triphenylpyrrol-3-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126084149 |
| Molecular Formula | C42H38ClN3OS |
| Molecular Weight | 668.31 g/mol |
| Exact Mass | 667.24 |
| IUPAC Name | (6S)-6-tert-butyl-N-(4-chlorophenyl)-2-[(1,2,5-triphenylpyrrol-3-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(C)(C)[C@H]1CCc2c(sc(N=Cc3cc(-c4ccccc4)n(-c4ccccc4)c3-c3ccccc3)c2C(=O)Nc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C42H38ClN3OS/c1-42(2,3)31-19-24-35-37(26-31)48-41(38(35)40(47)45-33-22-20-32(43)21-23-33)44-27-30-25-36(28-13-7-4-8-14-28)46(34-17-11-6-12-18-34)39(30)29-15-9-5-10-16-29/h4-18,20-23,25,27,31H,19,24,26H2,1-3H3,(H,45,47)/t31-/m0/s1 |
| InChIKey | FWMPSBOLVJDXAL-HKBQPEDESA-N |
| XLogP | 11.68 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.31 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|