C33H34ClN3O3S — CID 126091691
4-[3-[[(6S)-6-tert-butyl-3-[(4-chlorophenyl)carbamoyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]benzoic acid (PubChem CID 126091691) has the molecular formula C33H34ClN3O3S and a molecular weight of 588.17 g/mol. Its IUPAC name is 4-[3-[[(6S)-6-tert-butyl-3-[(4-chlorophenyl)carbamoyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]benzoic acid.
| Compound Name | 4-[3-[[(6S)-6-tert-butyl-3-[(4-chlorophenyl)carbamoyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 126091691 |
| Molecular Formula | C33H34ClN3O3S |
| Molecular Weight | 588.17 g/mol |
| Exact Mass | 587.20 |
| IUPAC Name | 4-[3-[[(6S)-6-tert-butyl-3-[(4-chlorophenyl)carbamoyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]benzoic acid |
| SMILES | Cc1cc(C=Nc2sc3c(c2C(=O)Nc2ccc(Cl)cc2)CC[C@H](C(C)(C)C)C3)c(C)n1-c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C33H34ClN3O3S/c1-19-16-22(20(2)37(19)26-13-6-21(7-14-26)32(39)40)18-35-31-29(30(38)36-25-11-9-24(34)10-12-25)27-15-8-23(33(3,4)5)17-28(27)41-31/h6-7,9-14,16,18,23H,8,15,17H2,1-5H3,(H,36,38)(H,39,40)/t23-/m0/s1 |
| InChIKey | ZFKKYUYWOUXUFX-QHCPKHFHSA-N |
| XLogP | 8.66 |
| TPSA | 83.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.17 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|