C24H14ClF3N4O2S — CID 126118582
N-(3-chlorophenyl)-1-[5-nitro-2-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylphenyl]methanimine (PubChem CID 126118582) has the molecular formula C24H14ClF3N4O2S and a molecular weight of 514.92 g/mol. Its IUPAC name is N-(3-chlorophenyl)-1-[5-nitro-2-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylphenyl]methanimine.
| Compound Name | N-(3-chlorophenyl)-1-[5-nitro-2-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylphenyl]methanimine |
|---|---|
| PubChem CID | 126118582 |
| Molecular Formula | C24H14ClF3N4O2S |
| Molecular Weight | 514.92 g/mol |
| Exact Mass | 514.05 |
| IUPAC Name | N-(3-chlorophenyl)-1-[5-nitro-2-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylphenyl]methanimine |
| SMILES | O=[N+]([O-])c1ccc(Sc2nc(-c3ccccc3)cc(C(F)(F)F)n2)c(/C=N/c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C24H14ClF3N4O2S/c25-17-7-4-8-18(12-17)29-14-16-11-19(32(33)34)9-10-21(16)35-23-30-20(15-5-2-1-3-6-15)13-22(31-23)24(26,27)28/h1-14H/b29-14+ |
| InChIKey | FOYQUXVXVAENTB-IPPBACCNSA-N |
| XLogP | 7.63 |
| TPSA | 81.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.92 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|