C27H19F3N6O4S — CID 126373267
4-acetamido-N-[(E)-[5-nitro-2-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylphenyl]methylideneamino]benzamide (PubChem CID 126373267) has the molecular formula C27H19F3N6O4S and a molecular weight of 580.55 g/mol. Its IUPAC name is 4-acetamido-N-[(E)-[5-nitro-2-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylphenyl]methylideneamino]benzamide.
| Compound Name | 4-acetamido-N-[(E)-[5-nitro-2-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylphenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126373267 |
| Molecular Formula | C27H19F3N6O4S |
| Molecular Weight | 580.55 g/mol |
| Exact Mass | 580.11 |
| IUPAC Name | 4-acetamido-N-[(E)-[5-nitro-2-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylphenyl]methylideneamino]benzamide |
| SMILES | CC(=O)Nc1ccc(C(=O)N/N=C/c2cc([N+](=O)[O-])ccc2Sc2nc(-c3ccccc3)cc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C27H19F3N6O4S/c1-16(37)32-20-9-7-18(8-10-20)25(38)35-31-15-19-13-21(36(39)40)11-12-23(19)41-26-33-22(17-5-3-2-4-6-17)14-24(34-26)27(28,29)30/h2-15H,1H3,(H,32,37)(H,35,38)/b31-15+ |
| InChIKey | FKOYRDQNJIEHGR-IBBHUPRXSA-N |
| XLogP | 5.94 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.55 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|