C18H16Cl2F3NO2 — CID 19191291
4-(4-chloro-3-methylphenoxy)-N-[2-chloro-5-(trifluoromethyl)phenyl]butanamide (PubChem CID 19191291) has the molecular formula C18H16Cl2F3NO2 and a molecular weight of 406.23 g/mol. Its IUPAC name is 4-(4-chloro-3-methylphenoxy)-N-[2-chloro-5-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 4-(4-chloro-3-methylphenoxy)-N-[2-chloro-5-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 19191291 |
| Molecular Formula | C18H16Cl2F3NO2 |
| Molecular Weight | 406.23 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | 4-(4-chloro-3-methylphenoxy)-N-[2-chloro-5-(trifluoromethyl)phenyl]butanamide |
| SMILES | Cc1cc(OCCCC(=O)Nc2cc(C(F)(F)F)ccc2Cl)ccc1Cl |
| InChI | InChI=1S/C18H16Cl2F3NO2/c1-11-9-13(5-7-14(11)19)26-8-2-3-17(25)24-16-10-12(18(21,22)23)4-6-15(16)20/h4-7,9-10H,2-3,8H2,1H3,(H,24,25) |
| InChIKey | PEVJDLJFMCURLI-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.23 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|