C19H22ClNO4S — CID 55613294
4-(4-chloro-3-methylphenoxy)-N-(2-ethylsulfonylphenyl)butanamide (PubChem CID 55613294) has the molecular formula C19H22ClNO4S and a molecular weight of 395.91 g/mol. Its IUPAC name is 4-(4-chloro-3-methylphenoxy)-N-(2-ethylsulfonylphenyl)butanamide.
| Compound Name | 4-(4-chloro-3-methylphenoxy)-N-(2-ethylsulfonylphenyl)butanamide |
|---|---|
| PubChem CID | 55613294 |
| Molecular Formula | C19H22ClNO4S |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 4-(4-chloro-3-methylphenoxy)-N-(2-ethylsulfonylphenyl)butanamide |
| SMILES | CCS(=O)(=O)c1ccccc1NC(=O)CCCOc1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C19H22ClNO4S/c1-3-26(23,24)18-8-5-4-7-17(18)21-19(22)9-6-12-25-15-10-11-16(20)14(2)13-15/h4-5,7-8,10-11,13H,3,6,9,12H2,1-2H3,(H,21,22) |
| InChIKey | XBBFGSJOEYMQHK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|