C24H21Cl2NO3 — CID 19191287
N-(2-benzoyl-4-chlorophenyl)-4-(4-chloro-3-methylphenoxy)butanamide (PubChem CID 19191287) has the molecular formula C24H21Cl2NO3 and a molecular weight of 442.34 g/mol. Its IUPAC name is N-(2-benzoyl-4-chlorophenyl)-4-(4-chloro-3-methylphenoxy)butanamide.
| Compound Name | N-(2-benzoyl-4-chlorophenyl)-4-(4-chloro-3-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 19191287 |
| Molecular Formula | C24H21Cl2NO3 |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | N-(2-benzoyl-4-chlorophenyl)-4-(4-chloro-3-methylphenoxy)butanamide |
| SMILES | Cc1cc(OCCCC(=O)Nc2ccc(Cl)cc2C(=O)c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C24H21Cl2NO3/c1-16-14-19(10-11-21(16)26)30-13-5-8-23(28)27-22-12-9-18(25)15-20(22)24(29)17-6-3-2-4-7-17/h2-4,6-7,9-12,14-15H,5,8,13H2,1H3,(H,27,28) |
| InChIKey | RMPKYWRYZFUPFN-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|