C26H27ClN2O3 — CID 15192415
2-benzoyl-4-chloro-N-[4-[3-(dimethylamino)propoxy]-2-methylphenyl]benzamide (PubChem CID 15192415) has the molecular formula C26H27ClN2O3 and a molecular weight of 450.97 g/mol. Its IUPAC name is 2-benzoyl-4-chloro-N-[4-[3-(dimethylamino)propoxy]-2-methylphenyl]benzamide.
| Compound Name | 2-benzoyl-4-chloro-N-[4-[3-(dimethylamino)propoxy]-2-methylphenyl]benzamide |
|---|---|
| PubChem CID | 15192415 |
| Molecular Formula | C26H27ClN2O3 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 2-benzoyl-4-chloro-N-[4-[3-(dimethylamino)propoxy]-2-methylphenyl]benzamide |
| SMILES | Cc1cc(OCCCN(C)C)ccc1NC(=O)c1ccc(Cl)cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C26H27ClN2O3/c1-18-16-21(32-15-7-14-29(2)3)11-13-24(18)28-26(31)22-12-10-20(27)17-23(22)25(30)19-8-5-4-6-9-19/h4-6,8-13,16-17H,7,14-15H2,1-3H3,(H,28,31) |
| InChIKey | JKVXRNIYLYQDFJ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|