C24H22ClNO3 — CID 4512457
N-(2-benzoyl-4-chlorophenyl)-3-(2-methylpropoxy)benzamide (PubChem CID 4512457) has the molecular formula C24H22ClNO3 and a molecular weight of 407.90 g/mol. Its IUPAC name is N-(2-benzoyl-4-chlorophenyl)-3-(2-methylpropoxy)benzamide.
| Compound Name | N-(2-benzoyl-4-chlorophenyl)-3-(2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 4512457 |
| Molecular Formula | C24H22ClNO3 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-(2-benzoyl-4-chlorophenyl)-3-(2-methylpropoxy)benzamide |
| SMILES | CC(C)COc1cccc(C(=O)Nc2ccc(Cl)cc2C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H22ClNO3/c1-16(2)15-29-20-10-6-9-18(13-20)24(28)26-22-12-11-19(25)14-21(22)23(27)17-7-4-3-5-8-17/h3-14,16H,15H2,1-2H3,(H,26,28) |
| InChIKey | FWCAZQFWQKNVHS-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |