C21H17ClF3NO6 — CID 126187370
[2-(4-acetyloxyphenyl)-2-oxoethyl] 4-[2-chloro-5-(trifluoromethyl)anilino]-4-oxobutanoate (PubChem CID 126187370) has the molecular formula C21H17ClF3NO6 and a molecular weight of 471.82 g/mol. Its IUPAC name is [2-(4-acetyloxyphenyl)-2-oxoethyl] 4-[2-chloro-5-(trifluoromethyl)anilino]-4-oxobutanoate.
| Compound Name | [2-(4-acetyloxyphenyl)-2-oxoethyl] 4-[2-chloro-5-(trifluoromethyl)anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 126187370 |
| Molecular Formula | C21H17ClF3NO6 |
| Molecular Weight | 471.82 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | [2-(4-acetyloxyphenyl)-2-oxoethyl] 4-[2-chloro-5-(trifluoromethyl)anilino]-4-oxobutanoate |
| SMILES | CC(=O)Oc1ccc(C(=O)COC(=O)CCC(=O)Nc2cc(C(F)(F)F)ccc2Cl)cc1 |
| InChI | InChI=1S/C21H17ClF3NO6/c1-12(27)32-15-5-2-13(3-6-15)18(28)11-31-20(30)9-8-19(29)26-17-10-14(21(23,24)25)4-7-16(17)22/h2-7,10H,8-9,11H2,1H3,(H,26,29) |
| InChIKey | WLWNICVCGCUFSN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.82 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|