C21H20N2O9 — CID 126186676
[2-(4-acetyloxyphenyl)-2-oxoethyl] 4-(4-methoxy-2-nitroanilino)-4-oxobutanoate (PubChem CID 126186676) has the molecular formula C21H20N2O9 and a molecular weight of 444.40 g/mol. Its IUPAC name is [2-(4-acetyloxyphenyl)-2-oxoethyl] 4-(4-methoxy-2-nitroanilino)-4-oxobutanoate.
| Compound Name | [2-(4-acetyloxyphenyl)-2-oxoethyl] 4-(4-methoxy-2-nitroanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 126186676 |
| Molecular Formula | C21H20N2O9 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | [2-(4-acetyloxyphenyl)-2-oxoethyl] 4-(4-methoxy-2-nitroanilino)-4-oxobutanoate |
| SMILES | COc1ccc(NC(=O)CCC(=O)OCC(=O)c2ccc(OC(C)=O)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H20N2O9/c1-13(24)32-15-5-3-14(4-6-15)19(25)12-31-21(27)10-9-20(26)22-17-8-7-16(30-2)11-18(17)23(28)29/h3-8,11H,9-10,12H2,1-2H3,(H,22,26) |
| InChIKey | RZSWKWYSBIPSGC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 151.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|