C14H17N3O6S — CID 4939886
ethyl 4-[(4-methoxy-2-nitrophenyl)carbamothioylamino]-4-oxobutanoate (PubChem CID 4939886) has the molecular formula C14H17N3O6S and a molecular weight of 355.37 g/mol. Its IUPAC name is ethyl 4-[(4-methoxy-2-nitrophenyl)carbamothioylamino]-4-oxobutanoate.
| Compound Name | ethyl 4-[(4-methoxy-2-nitrophenyl)carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4939886 |
| Molecular Formula | C14H17N3O6S |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | ethyl 4-[(4-methoxy-2-nitrophenyl)carbamothioylamino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)NC(=S)Nc1ccc(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17N3O6S/c1-3-23-13(19)7-6-12(18)16-14(24)15-10-5-4-9(22-2)8-11(10)17(20)21/h4-5,8H,3,6-7H2,1-2H3,(H2,15,16,18,24) |
| InChIKey | AZLUXIOXKBGTQB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|