C14H19N3O4S — CID 19189245
N-[(4-methoxy-2-nitrophenyl)carbamothioyl]-3,3-dimethylbutanamide (PubChem CID 19189245) has the molecular formula C14H19N3O4S and a molecular weight of 325.39 g/mol. Its IUPAC name is N-[(4-methoxy-2-nitrophenyl)carbamothioyl]-3,3-dimethylbutanamide.
| Compound Name | N-[(4-methoxy-2-nitrophenyl)carbamothioyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 19189245 |
| Molecular Formula | C14H19N3O4S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N-[(4-methoxy-2-nitrophenyl)carbamothioyl]-3,3-dimethylbutanamide |
| SMILES | COc1ccc(NC(=S)NC(=O)CC(C)(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H19N3O4S/c1-14(2,3)8-12(18)16-13(22)15-10-6-5-9(21-4)7-11(10)17(19)20/h5-7H,8H2,1-4H3,(H2,15,16,18,22) |
| InChIKey | YXUYMVMSCQSRTL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|