C14H17N3O6S — CID 4933504
propyl 4-[(2-hydroxy-4-nitrophenyl)carbamothioylamino]-4-oxobutanoate (PubChem CID 4933504) has the molecular formula C14H17N3O6S and a molecular weight of 355.37 g/mol. Its IUPAC name is propyl 4-[(2-hydroxy-4-nitrophenyl)carbamothioylamino]-4-oxobutanoate.
| Compound Name | propyl 4-[(2-hydroxy-4-nitrophenyl)carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4933504 |
| Molecular Formula | C14H17N3O6S |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | propyl 4-[(2-hydroxy-4-nitrophenyl)carbamothioylamino]-4-oxobutanoate |
| SMILES | CCCOC(=O)CCC(=O)NC(=S)Nc1ccc([N+](=O)[O-])cc1O |
| InChI | InChI=1S/C14H17N3O6S/c1-2-7-23-13(20)6-5-12(19)16-14(24)15-10-4-3-9(17(21)22)8-11(10)18/h3-4,8,18H,2,5-7H2,1H3,(H2,15,16,19,24) |
| InChIKey | PUQZCEQYZGDJAM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|