C21H20N2O8 — CID 126184937
[2-(4-acetyloxyphenyl)-2-oxoethyl] 4-(4-methyl-2-nitroanilino)-4-oxobutanoate (PubChem CID 126184937) has the molecular formula C21H20N2O8 and a molecular weight of 428.40 g/mol. Its IUPAC name is [2-(4-acetyloxyphenyl)-2-oxoethyl] 4-(4-methyl-2-nitroanilino)-4-oxobutanoate.
| Compound Name | [2-(4-acetyloxyphenyl)-2-oxoethyl] 4-(4-methyl-2-nitroanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 126184937 |
| Molecular Formula | C21H20N2O8 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | [2-(4-acetyloxyphenyl)-2-oxoethyl] 4-(4-methyl-2-nitroanilino)-4-oxobutanoate |
| SMILES | CC(=O)Oc1ccc(C(=O)COC(=O)CCC(=O)Nc2ccc(C)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H20N2O8/c1-13-3-8-17(18(11-13)23(28)29)22-20(26)9-10-21(27)30-12-19(25)15-4-6-16(7-5-15)31-14(2)24/h3-8,11H,9-10,12H2,1-2H3,(H,22,26) |
| InChIKey | MNKISLADRFISDS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|