C15H18ClF3N2O2 — CID 108951833
N'-[2-chloro-5-(trifluoromethyl)phenyl]-N-(3-methylbutyl)propanediamide (PubChem CID 108951833) has the molecular formula C15H18ClF3N2O2 and a molecular weight of 350.77 g/mol. Its IUPAC name is N'-[2-chloro-5-(trifluoromethyl)phenyl]-N-(3-methylbutyl)propanediamide.
| Compound Name | N'-[2-chloro-5-(trifluoromethyl)phenyl]-N-(3-methylbutyl)propanediamide |
|---|---|
| PubChem CID | 108951833 |
| Molecular Formula | C15H18ClF3N2O2 |
| Molecular Weight | 350.77 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | N'-[2-chloro-5-(trifluoromethyl)phenyl]-N-(3-methylbutyl)propanediamide |
| SMILES | CC(C)CCNC(=O)CC(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C15H18ClF3N2O2/c1-9(2)5-6-20-13(22)8-14(23)21-12-7-10(15(17,18)19)3-4-11(12)16/h3-4,7,9H,5-6,8H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | VLUKUPYGEIUQBY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.77 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|