C16H13ClF3N3O2 — CID 108947865
N'-[2-chloro-5-(trifluoromethyl)phenyl]-N-(pyridin-4-ylmethyl)propanediamide (PubChem CID 108947865) has the molecular formula C16H13ClF3N3O2 and a molecular weight of 371.75 g/mol. Its IUPAC name is N'-[2-chloro-5-(trifluoromethyl)phenyl]-N-(pyridin-4-ylmethyl)propanediamide.
| Compound Name | N'-[2-chloro-5-(trifluoromethyl)phenyl]-N-(pyridin-4-ylmethyl)propanediamide |
|---|---|
| PubChem CID | 108947865 |
| Molecular Formula | C16H13ClF3N3O2 |
| Molecular Weight | 371.75 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | N'-[2-chloro-5-(trifluoromethyl)phenyl]-N-(pyridin-4-ylmethyl)propanediamide |
| SMILES | O=C(CC(=O)Nc1cc(C(F)(F)F)ccc1Cl)NCc1ccncc1 |
| InChI | InChI=1S/C16H13ClF3N3O2/c17-12-2-1-11(16(18,19)20)7-13(12)23-15(25)8-14(24)22-9-10-3-5-21-6-4-10/h1-7H,8-9H2,(H,22,24)(H,23,25) |
| InChIKey | ZCXRAKGGQJKSKS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.75 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|