C25H24I4N2O5 — CID 99655861
[2-oxo-2-(2-propan-2-ylanilino)ethyl] (2R)-4-methyl-2-(4,5,6,7-tetraiodo-1,3-dioxoisoindol-2-yl)pentanoate (PubChem CID 99655861) has the molecular formula C25H24I4N2O5 and a molecular weight of 940.09 g/mol. Its IUPAC name is [2-oxo-2-(2-propan-2-ylanilino)ethyl] (2R)-4-methyl-2-(4,5,6,7-tetraiodo-1,3-dioxoisoindol-2-yl)pentanoate.
| Compound Name | [2-oxo-2-(2-propan-2-ylanilino)ethyl] (2R)-4-methyl-2-(4,5,6,7-tetraiodo-1,3-dioxoisoindol-2-yl)pentanoate |
|---|---|
| PubChem CID | 99655861 |
| Molecular Formula | C25H24I4N2O5 |
| Molecular Weight | 940.09 g/mol |
| Exact Mass | 939.79 |
| IUPAC Name | [2-oxo-2-(2-propan-2-ylanilino)ethyl] (2R)-4-methyl-2-(4,5,6,7-tetraiodo-1,3-dioxoisoindol-2-yl)pentanoate |
| SMILES | CC(C)C[C@H](C(=O)OCC(=O)Nc1ccccc1C(C)C)N1C(=O)c2c(I)c(I)c(I)c(I)c2C1=O |
| InChI | InChI=1S/C25H24I4N2O5/c1-11(2)9-15(25(35)36-10-16(32)30-14-8-6-5-7-13(14)12(3)4)31-23(33)17-18(24(31)34)20(27)22(29)21(28)19(17)26/h5-8,11-12,15H,9-10H2,1-4H3,(H,30,32)/t15-/m1/s1 |
| InChIKey | SFFFVLXHWHKZKV-OAHLLOKOSA-N |
| XLogP | 6.42 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.09 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|