C23H14Cl4N2O5 — CID 1404125
[2-(naphthalen-1-ylamino)-2-oxoethyl] (2S)-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 1404125) has the molecular formula C23H14Cl4N2O5 and a molecular weight of 540.19 g/mol. Its IUPAC name is [2-(naphthalen-1-ylamino)-2-oxoethyl] (2S)-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] (2S)-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 1404125 |
| Molecular Formula | C23H14Cl4N2O5 |
| Molecular Weight | 540.19 g/mol |
| Exact Mass | 537.97 |
| IUPAC Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] (2S)-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | C[C@@H](C(=O)OCC(=O)Nc1cccc2ccccc12)N1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C23H14Cl4N2O5/c1-10(29-21(31)15-16(22(29)32)18(25)20(27)19(26)17(15)24)23(33)34-9-14(30)28-13-8-4-6-11-5-2-3-7-12(11)13/h2-8,10H,9H2,1H3,(H,28,30)/t10-/m0/s1 |
| InChIKey | AWESJKWAVPDIRY-JTQLQIEISA-N |
| XLogP | 5.62 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.19 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|