C19H10Cl4FNO5 — CID 2914758
[2-(4-fluorophenyl)-2-oxoethyl] 2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 2914758) has the molecular formula C19H10Cl4FNO5 and a molecular weight of 493.10 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 2914758 |
| Molecular Formula | C19H10Cl4FNO5 |
| Molecular Weight | 493.10 g/mol |
| Exact Mass | 490.93 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CC(C(=O)OCC(=O)c1ccc(F)cc1)N1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C19H10Cl4FNO5/c1-7(19(29)30-6-10(26)8-2-4-9(24)5-3-8)25-17(27)11-12(18(25)28)14(21)16(23)15(22)13(11)20/h2-5,7H,6H2,1H3 |
| InChIKey | DNMGTOZKYIWVOW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.10 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|