C21H15Cl4NO5S — CID 98277638
phenacyl (2S)-4-methylsulfanyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 98277638) has the molecular formula C21H15Cl4NO5S and a molecular weight of 535.23 g/mol. Its IUPAC name is phenacyl (2S)-4-methylsulfanyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | phenacyl (2S)-4-methylsulfanyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 98277638 |
| Molecular Formula | C21H15Cl4NO5S |
| Molecular Weight | 535.23 g/mol |
| Exact Mass | 532.94 |
| IUPAC Name | phenacyl (2S)-4-methylsulfanyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | CSCC[C@@H](C(=O)OCC(=O)c1ccccc1)N1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C21H15Cl4NO5S/c1-32-8-7-11(21(30)31-9-12(27)10-5-3-2-4-6-10)26-19(28)13-14(20(26)29)16(23)18(25)17(24)15(13)22/h2-6,11H,7-9H2,1H3/t11-/m0/s1 |
| InChIKey | XOBINOSIFHEPSS-NSHDSACASA-N |
| XLogP | 5.44 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.23 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|