C27H20Cl4N2O5 — CID 5205803
[2-(2,3-dimethylanilino)-2-oxoethyl] 3-phenyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 5205803) has the molecular formula C27H20Cl4N2O5 and a molecular weight of 594.28 g/mol. Its IUPAC name is [2-(2,3-dimethylanilino)-2-oxoethyl] 3-phenyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-(2,3-dimethylanilino)-2-oxoethyl] 3-phenyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 5205803 |
| Molecular Formula | C27H20Cl4N2O5 |
| Molecular Weight | 594.28 g/mol |
| Exact Mass | 592.01 |
| IUPAC Name | [2-(2,3-dimethylanilino)-2-oxoethyl] 3-phenyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | Cc1cccc(NC(=O)COC(=O)C(Cc2ccccc2)N2C(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C2=O)c1C |
| InChI | InChI=1S/C27H20Cl4N2O5/c1-13-7-6-10-16(14(13)2)32-18(34)12-38-27(37)17(11-15-8-4-3-5-9-15)33-25(35)19-20(26(33)36)22(29)24(31)23(30)21(19)28/h3-10,17H,11-12H2,1-2H3,(H,32,34) |
| InChIKey | SATDCKMNNYXNFO-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.28 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|