C19H12Cl3NO3 — CID 2400883
[2-(naphthalen-1-ylamino)-2-oxoethyl] 2,3,6-trichlorobenzoate (PubChem CID 2400883) has the molecular formula C19H12Cl3NO3 and a molecular weight of 408.67 g/mol. Its IUPAC name is [2-(naphthalen-1-ylamino)-2-oxoethyl] 2,3,6-trichlorobenzoate.
| Compound Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] 2,3,6-trichlorobenzoate |
|---|---|
| PubChem CID | 2400883 |
| Molecular Formula | C19H12Cl3NO3 |
| Molecular Weight | 408.67 g/mol |
| Exact Mass | 406.99 |
| IUPAC Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] 2,3,6-trichlorobenzoate |
| SMILES | O=C(COC(=O)c1c(Cl)ccc(Cl)c1Cl)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C19H12Cl3NO3/c20-13-8-9-14(21)18(22)17(13)19(25)26-10-16(24)23-15-7-3-5-11-4-1-2-6-12(11)15/h1-9H,10H2,(H,23,24) |
| InChIKey | WMGYPURDUWAWIO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.67 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|