C33H30N2O5 — CID 126230311
[2-[4-(1-adamantyl)anilino]-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 126230311) has the molecular formula C33H30N2O5 and a molecular weight of 534.61 g/mol. Its IUPAC name is [2-[4-(1-adamantyl)anilino]-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [2-[4-(1-adamantyl)anilino]-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 126230311 |
| Molecular Formula | C33H30N2O5 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | [2-[4-(1-adamantyl)anilino]-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | O=C(COC(=O)c1cccc(N2C(=O)c3ccccc3C2=O)c1)Nc1ccc(C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C33H30N2O5/c36-29(34-25-10-8-24(9-11-25)33-16-20-12-21(17-33)14-22(13-20)18-33)19-40-32(39)23-4-3-5-26(15-23)35-30(37)27-6-1-2-7-28(27)31(35)38/h1-11,15,20-22H,12-14,16-19H2,(H,34,36) |
| InChIKey | KNBUGJTVIJGECT-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|