C19H17NO5S — CID 51684466
[(1R)-2-(furan-2-ylmethylamino)-1-(4-methoxyphenyl)-2-oxoethyl] thiophene-2-carboxylate (PubChem CID 51684466) has the molecular formula C19H17NO5S and a molecular weight of 371.41 g/mol. Its IUPAC name is [(1R)-2-(furan-2-ylmethylamino)-1-(4-methoxyphenyl)-2-oxoethyl] thiophene-2-carboxylate.
| Compound Name | [(1R)-2-(furan-2-ylmethylamino)-1-(4-methoxyphenyl)-2-oxoethyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 51684466 |
| Molecular Formula | C19H17NO5S |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | [(1R)-2-(furan-2-ylmethylamino)-1-(4-methoxyphenyl)-2-oxoethyl] thiophene-2-carboxylate |
| SMILES | COc1ccc([C@@H](OC(=O)c2cccs2)C(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C19H17NO5S/c1-23-14-8-6-13(7-9-14)17(25-19(22)16-5-3-11-26-16)18(21)20-12-15-4-2-10-24-15/h2-11,17H,12H2,1H3,(H,20,21)/t17-/m1/s1 |
| InChIKey | JULGFGGKDBRBNN-QGZVFWFLSA-N |
| XLogP | 3.56 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |