C24H20N2O4S — CID 43814239
[2-[(4-methoxyphenyl)methylamino]-2-oxo-1-quinolin-6-ylethyl] thiophene-2-carboxylate (PubChem CID 43814239) has the molecular formula C24H20N2O4S and a molecular weight of 432.50 g/mol. Its IUPAC name is [2-[(4-methoxyphenyl)methylamino]-2-oxo-1-quinolin-6-ylethyl] thiophene-2-carboxylate.
| Compound Name | [2-[(4-methoxyphenyl)methylamino]-2-oxo-1-quinolin-6-ylethyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 43814239 |
| Molecular Formula | C24H20N2O4S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | [2-[(4-methoxyphenyl)methylamino]-2-oxo-1-quinolin-6-ylethyl] thiophene-2-carboxylate |
| SMILES | COc1ccc(CNC(=O)C(OC(=O)c2cccs2)c2ccc3ncccc3c2)cc1 |
| InChI | InChI=1S/C24H20N2O4S/c1-29-19-9-6-16(7-10-19)15-26-23(27)22(30-24(28)21-5-3-13-31-21)18-8-11-20-17(14-18)4-2-12-25-20/h2-14,22H,15H2,1H3,(H,26,27) |
| InChIKey | BCUYDBGTAFFXJK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |