C23H23NO4S — CID 3227610
[1-(4-ethoxyphenyl)-2-[(4-methylphenyl)methylamino]-2-oxoethyl] thiophene-2-carboxylate (PubChem CID 3227610) has the molecular formula C23H23NO4S and a molecular weight of 409.51 g/mol. Its IUPAC name is [1-(4-ethoxyphenyl)-2-[(4-methylphenyl)methylamino]-2-oxoethyl] thiophene-2-carboxylate.
| Compound Name | [1-(4-ethoxyphenyl)-2-[(4-methylphenyl)methylamino]-2-oxoethyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 3227610 |
| Molecular Formula | C23H23NO4S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | [1-(4-ethoxyphenyl)-2-[(4-methylphenyl)methylamino]-2-oxoethyl] thiophene-2-carboxylate |
| SMILES | CCOc1ccc(C(OC(=O)c2cccs2)C(=O)NCc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H23NO4S/c1-3-27-19-12-10-18(11-13-19)21(28-23(26)20-5-4-14-29-20)22(25)24-15-17-8-6-16(2)7-9-17/h4-14,21H,3,15H2,1-2H3,(H,24,25) |
| InChIKey | VCVIIVJRWJSVHL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |