C15H16N2O4S — CID 43817599
[2-(2-methoxyethylamino)-2-oxo-1-pyridin-4-ylethyl] thiophene-2-carboxylate (PubChem CID 43817599) has the molecular formula C15H16N2O4S and a molecular weight of 320.37 g/mol. Its IUPAC name is [2-(2-methoxyethylamino)-2-oxo-1-pyridin-4-ylethyl] thiophene-2-carboxylate.
| Compound Name | [2-(2-methoxyethylamino)-2-oxo-1-pyridin-4-ylethyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 43817599 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | [2-(2-methoxyethylamino)-2-oxo-1-pyridin-4-ylethyl] thiophene-2-carboxylate |
| SMILES | COCCNC(=O)C(OC(=O)c1cccs1)c1ccncc1 |
| InChI | InChI=1S/C15H16N2O4S/c1-20-9-8-17-14(18)13(11-4-6-16-7-5-11)21-15(19)12-3-2-10-22-12/h2-7,10,13H,8-9H2,1H3,(H,17,18) |
| InChIKey | KLWRAAIBHMPXIA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|