C18H14ClNO4S — CID 3220319
[1-(4-chlorophenyl)-2-(furan-2-ylmethylamino)-2-oxoethyl] thiophene-2-carboxylate (PubChem CID 3220319) has the molecular formula C18H14ClNO4S and a molecular weight of 375.83 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-2-(furan-2-ylmethylamino)-2-oxoethyl] thiophene-2-carboxylate.
| Compound Name | [1-(4-chlorophenyl)-2-(furan-2-ylmethylamino)-2-oxoethyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 3220319 |
| Molecular Formula | C18H14ClNO4S |
| Molecular Weight | 375.83 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | [1-(4-chlorophenyl)-2-(furan-2-ylmethylamino)-2-oxoethyl] thiophene-2-carboxylate |
| SMILES | O=C(OC(C(=O)NCc1ccco1)c1ccc(Cl)cc1)c1cccs1 |
| InChI | InChI=1S/C18H14ClNO4S/c19-13-7-5-12(6-8-13)16(24-18(22)15-4-2-10-25-15)17(21)20-11-14-3-1-9-23-14/h1-10,16H,11H2,(H,20,21) |
| InChIKey | IMKQJKRVZIUETI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.83 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |