C16H16FN3O6S2 — CID 31801854
[2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 2-fluoro-5-(methylsulfamoyl)benzoate (PubChem CID 31801854) has the molecular formula C16H16FN3O6S2 and a molecular weight of 429.45 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 2-fluoro-5-(methylsulfamoyl)benzoate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 2-fluoro-5-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 31801854 |
| Molecular Formula | C16H16FN3O6S2 |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 2-fluoro-5-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1ccc(F)c(C(=O)OCC(=O)NC(=O)NCc2cccs2)c1 |
| InChI | InChI=1S/C16H16FN3O6S2/c1-18-28(24,25)11-4-5-13(17)12(7-11)15(22)26-9-14(21)20-16(23)19-8-10-3-2-6-27-10/h2-7,18H,8-9H2,1H3,(H2,19,20,21,23) |
| InChIKey | UORQGIRZUVVZGK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |