C16H22N2O5S — CID 24626790
[2-oxo-2-(2-thiophen-2-ylethylcarbamoylamino)ethyl] 1-hydroxycyclohexane-1-carboxylate (PubChem CID 24626790) has the molecular formula C16H22N2O5S and a molecular weight of 354.43 g/mol. Its IUPAC name is [2-oxo-2-(2-thiophen-2-ylethylcarbamoylamino)ethyl] 1-hydroxycyclohexane-1-carboxylate.
| Compound Name | [2-oxo-2-(2-thiophen-2-ylethylcarbamoylamino)ethyl] 1-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 24626790 |
| Molecular Formula | C16H22N2O5S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | [2-oxo-2-(2-thiophen-2-ylethylcarbamoylamino)ethyl] 1-hydroxycyclohexane-1-carboxylate |
| SMILES | O=C(COC(=O)C1(O)CCCCC1)NC(=O)NCCc1cccs1 |
| InChI | InChI=1S/C16H22N2O5S/c19-13(11-23-14(20)16(22)7-2-1-3-8-16)18-15(21)17-9-6-12-5-4-10-24-12/h4-5,10,22H,1-3,6-9,11H2,(H2,17,18,19,21) |
| InChIKey | BTJFERDVTVPIBD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |