C17H20N2O4S2 — CID 46518980
[2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] 3-acetamido-3-thiophen-2-ylpropanoate (PubChem CID 46518980) has the molecular formula C17H20N2O4S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] 3-acetamido-3-thiophen-2-ylpropanoate.
| Compound Name | [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] 3-acetamido-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 46518980 |
| Molecular Formula | C17H20N2O4S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] 3-acetamido-3-thiophen-2-ylpropanoate |
| SMILES | CC(=O)NC(CC(=O)OCC(=O)N(C)Cc1ccsc1)c1cccs1 |
| InChI | InChI=1S/C17H20N2O4S2/c1-12(20)18-14(15-4-3-6-25-15)8-17(22)23-10-16(21)19(2)9-13-5-7-24-11-13/h3-7,11,14H,8-10H2,1-2H3,(H,18,20) |
| InChIKey | SZPLMYGCDBJNSO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |