C21H15FN2O2S2 — CID 90626948
N-[2-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]phenyl]benzenesulfonamide (PubChem CID 90626948) has the molecular formula C21H15FN2O2S2 and a molecular weight of 410.50 g/mol. Its IUPAC name is N-[2-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]phenyl]benzenesulfonamide.
| Compound Name | N-[2-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90626948 |
| Molecular Formula | C21H15FN2O2S2 |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | N-[2-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1-c1csc(-c2ccccc2F)n1)c1ccccc1 |
| InChI | InChI=1S/C21H15FN2O2S2/c22-18-12-6-4-10-16(18)21-23-20(14-27-21)17-11-5-7-13-19(17)24-28(25,26)15-8-2-1-3-9-15/h1-14,24H |
| InChIKey | DKHNAJGOJPGQOQ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |