C16H14N2O2S2 — CID 90626836
N-[2-(2-methyl-1,3-thiazol-4-yl)phenyl]benzenesulfonamide (PubChem CID 90626836) has the molecular formula C16H14N2O2S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is N-[2-(2-methyl-1,3-thiazol-4-yl)phenyl]benzenesulfonamide.
| Compound Name | N-[2-(2-methyl-1,3-thiazol-4-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90626836 |
| Molecular Formula | C16H14N2O2S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | N-[2-(2-methyl-1,3-thiazol-4-yl)phenyl]benzenesulfonamide |
| SMILES | Cc1nc(-c2ccccc2NS(=O)(=O)c2ccccc2)cs1 |
| InChI | InChI=1S/C16H14N2O2S2/c1-12-17-16(11-21-12)14-9-5-6-10-15(14)18-22(19,20)13-7-3-2-4-8-13/h2-11,18H,1H3 |
| InChIKey | ZSXWRWBXIYMGEH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |