C15H16ClNO7S2 — CID 168639518
4-(benzenesulfonyloxy)-3-[(3-chloro-2-hydroxypropyl)amino]benzenesulfonic acid (PubChem CID 168639518) has the molecular formula C15H16ClNO7S2 and a molecular weight of 421.88 g/mol. Its IUPAC name is 4-(benzenesulfonyloxy)-3-[(3-chloro-2-hydroxypropyl)amino]benzenesulfonic acid.
| Compound Name | 4-(benzenesulfonyloxy)-3-[(3-chloro-2-hydroxypropyl)amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 168639518 |
| Molecular Formula | C15H16ClNO7S2 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.01 |
| IUPAC Name | 4-(benzenesulfonyloxy)-3-[(3-chloro-2-hydroxypropyl)amino]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(OS(=O)(=O)c2ccccc2)c(NCC(O)CCl)c1 |
| InChI | InChI=1S/C15H16ClNO7S2/c16-9-11(18)10-17-14-8-13(25(19,20)21)6-7-15(14)24-26(22,23)12-4-2-1-3-5-12/h1-8,11,17-18H,9-10H2,(H,19,20,21) |
| InChIKey | AVYXPEHTNLXBOD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|