C23H17ClN2O4S — CID 168517724
2-[2-chloro-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]isoindole-1,3-dione (PubChem CID 168517724) has the molecular formula C23H17ClN2O4S and a molecular weight of 452.92 g/mol. Its IUPAC name is 2-[2-chloro-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]isoindole-1,3-dione.
| Compound Name | 2-[2-chloro-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168517724 |
| Molecular Formula | C23H17ClN2O4S |
| Molecular Weight | 452.92 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 2-[2-chloro-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1cc(S(=O)(=O)N2CCCc3ccccc32)ccc1Cl |
| InChI | InChI=1S/C23H17ClN2O4S/c24-19-12-11-16(31(29,30)25-13-5-7-15-6-1-4-10-20(15)25)14-21(19)26-22(27)17-8-2-3-9-18(17)23(26)28/h1-4,6,8-12,14H,5,7,13H2 |
| InChIKey | PPFIFTLUQHQXFV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.92 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|