C17H17Cl2N3O2S — CID 169367214
2-chloro-N'-[2-chloro-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]ethanimidamide (PubChem CID 169367214) has the molecular formula C17H17Cl2N3O2S and a molecular weight of 398.32 g/mol. Its IUPAC name is 2-chloro-N'-[2-chloro-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[2-chloro-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169367214 |
| Molecular Formula | C17H17Cl2N3O2S |
| Molecular Weight | 398.32 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | 2-chloro-N'-[2-chloro-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]ethanimidamide |
| SMILES | N/C(CCl)=N/c1cc(S(=O)(=O)N2CCCc3ccccc32)ccc1Cl |
| InChI | InChI=1S/C17H17Cl2N3O2S/c18-11-17(20)21-15-10-13(7-8-14(15)19)25(23,24)22-9-3-5-12-4-1-2-6-16(12)22/h1-2,4,6-8,10H,3,5,9,11H2,(H2,20,21) |
| InChIKey | BWLQUQQDYWRXIF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.32 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|