C22H19Cl2N3O2S2 — CID 25237380
1-(3,4-dichlorophenyl)-3-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]thiourea (PubChem CID 25237380) has the molecular formula C22H19Cl2N3O2S2 and a molecular weight of 492.45 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]thiourea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]thiourea |
|---|---|
| PubChem CID | 25237380 |
| Molecular Formula | C22H19Cl2N3O2S2 |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 491.03 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]thiourea |
| SMILES | O=S(=O)(c1ccc(NC(=S)Nc2ccc(Cl)c(Cl)c2)cc1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C22H19Cl2N3O2S2/c23-19-12-9-17(14-20(19)24)26-22(30)25-16-7-10-18(11-8-16)31(28,29)27-13-3-5-15-4-1-2-6-21(15)27/h1-2,4,6-12,14H,3,5,13H2,(H2,25,26,30) |
| InChIKey | XZNVTSVPAUXQET-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|